Ph-Bis(C1-N-(C2-NH-Boc)2)
95%
blur_circular Chemical Specifications
description Product Description
This chemical is primarily utilized in the synthesis of complex organic molecules, particularly in peptide and protein chemistry. It serves as a key intermediate in the preparation of protected amino acid derivatives, which are essential for solid-phase peptide synthesis (SPPS). The Boc (tert-butoxycarbonyl) protecting groups in the structure play a crucial role in safeguarding amine functionalities during multi-step synthetic processes, ensuring selective reactions and preventing unwanted side reactions. Additionally, it is employed in the development of pharmaceuticals and bioactive compounds, where precise control over molecular structure is critical. Its application extends to research in medicinal chemistry, enabling the creation of novel drug candidates and therapeutic agents.
shopping_cart Available Sizes & Pricing
Cart
No products